About [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol
[4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol (PubChem CID 91183133) has the molecular formula C6H8N4O2
and a molecular weight of 168.16 g/mol. Its IUPAC name is [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol |
| PubChem CID | 91183133 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol |
| SMILES | [N-]=[N+]=NCCc1coc(CO)n1 |
| InChI | InChI=1S/C6H8N4O2/c7-10-8-2-1-5-4-12-6(3-11)9-5/h4,11H,1-3H2 |
| InChIKey | MEHPAQWLROSMRZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol?
The IUPAC name of [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol (CID 91183133) is [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol.
What is the SMILES notation for [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol?
The canonical SMILES for [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol is [N-]=[N+]=NCCc1coc(CO)n1.
What is the InChIKey of [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol?
The InChIKey is MEHPAQWLROSMRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2/c7-10-8-2-1-5-4-12-6(3-11)9-5/h4,11H,1-3H2.
What are the key properties of [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol?
[4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol has a molecular weight of 168.16 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-azidoethyl)-1,3-oxazol-2-yl]methanol is sourced from PubChem (CID 91183133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).