C19H22N2S — CID 911834
2-ethylspiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-thione (PubChem CID 911834) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is 2-ethylspiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-thione.
| Compound Name | 2-ethylspiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-thione |
|---|---|
| PubChem CID | 911834 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-ethylspiro[1,6-dihydrobenzo[h]quinazoline-5,1'-cyclohexane]-4-thione |
| SMILES | CCc1nc(=S)c2c([nH]1)-c1ccccc1CC21CCCCC1 |
| InChI | InChI=1S/C19H22N2S/c1-2-15-20-17-14-9-5-4-8-13(14)12-19(10-6-3-7-11-19)16(17)18(22)21-15/h4-5,8-9H,2-3,6-7,10-12H2,1H3,(H,20,21,22) |
| InChIKey | KSBKJLHUVJKYQL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|