C27H45NO3-2 — CID 91183622
tert-butyl 4-[(2E,4E)-6-butyl-5-(hydroxymethyl)-6,8-dimethyldeca-2,4,7-trien-2-yl]piperidine-1-carboxylate (PubChem CID 91183622) has the molecular formula C27H45NO3-2 and a molecular weight of 431.66 g/mol. Its IUPAC name is tert-butyl 4-[(2E,4E)-6-butyl-5-(hydroxymethyl)-6,8-dimethyldeca-2,4,7-trien-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2E,4E)-6-butyl-5-(hydroxymethyl)-6,8-dimethyldeca-2,4,7-trien-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91183622 |
| Molecular Formula | C27H45NO3-2 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | tert-butyl 4-[(2E,4E)-6-butyl-5-(hydroxymethyl)-6,8-dimethyldeca-2,4,7-trien-2-yl]piperidine-1-carboxylate |
| SMILES | [CH2-]CCCC(C)(C=C(C)[CH-]C)/C(=C\C=C(/C)C1CCN(C(=O)OC(C)(C)C)CC1)CO |
| InChI | InChI=1S/C27H45NO3/c1-9-11-16-27(8,19-21(3)10-2)24(20-29)13-12-22(4)23-14-17-28(18-15-23)25(30)31-26(5,6)7/h10,12-13,19,23,29H,1,9,11,14-18,20H2,2-8H3/q-2/b21-19?,22-12+,24-13- |
| InChIKey | QMVOTTCPWFGIOI-DHMZZDLCSA-N |
| XLogP | 6.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|