C19H11N2O+ — CID 91183657
18-aza-20-azoniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaene 20-oxide (PubChem CID 91183657) has the molecular formula C19H11N2O+ and a molecular weight of 283.31 g/mol. Its IUPAC name is 18-aza-20-azoniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaene 20-oxide.
| Compound Name | 18-aza-20-azoniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaene 20-oxide |
|---|---|
| PubChem CID | 91183657 |
| Molecular Formula | C19H11N2O+ |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 18-aza-20-azoniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2,4,6,8,10,12,14,16,18-decaene 20-oxide |
| SMILES | O=[N+]1C=NC=c2ccc3ccc4c(c3c21)=Cc1ccccc1-4 |
| InChI | InChI=1S/C19H11N2O/c22-21-11-20-10-14-6-5-12-7-8-16-15-4-2-1-3-13(15)9-17(16)18(12)19(14)21/h1-11H/q+1 |
| InChIKey | BPPXOFRGKMRBGP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|