C25H44O7Si — CID 91183663
[(2S,3S,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-prop-2-enyloxan-3-yl] propanoate (PubChem CID 91183663) has the molecular formula C25H44O7Si and a molecular weight of 484.71 g/mol. Its IUPAC name is [(2S,3S,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-prop-2-enyloxan-3-yl] propanoate.
| Compound Name | [(2S,3S,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-prop-2-enyloxan-3-yl] propanoate |
|---|---|
| PubChem CID | 91183663 |
| Molecular Formula | C25H44O7Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | [(2S,3S,6R)-2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-prop-2-enyloxan-3-yl] propanoate |
| SMILES | C=CC[C@@H]1CC(=CC(=O)OC)[C@H](OC(=O)CC)[C@](OC)(C(C)(C)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H44O7Si/c1-12-14-19-15-18(16-21(27)28-8)22(31-20(26)13-2)25(29-9,32-19)24(6,7)17-30-33(10,11)23(3,4)5/h12,16,19,22H,1,13-15,17H2,2-11H3/t19-,22+,25-/m1/s1 |
| InChIKey | MDQOPQSWKUSVMS-RZTXVSJASA-N |
| XLogP | 5.16 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|