C31H44N6O3 — CID 91183730
1-[4-[7-acetyl-4-(3-methylmorpholin-4-yl)-8-prop-2-enyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]phenyl]-3-(4,4-dimethylpentyl)urea (PubChem CID 91183730) has the molecular formula C31H44N6O3 and a molecular weight of 548.73 g/mol. Its IUPAC name is 1-[4-[7-acetyl-4-(3-methylmorpholin-4-yl)-8-prop-2-enyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]phenyl]-3-(4,4-dimethylpentyl)urea.
| Compound Name | 1-[4-[7-acetyl-4-(3-methylmorpholin-4-yl)-8-prop-2-enyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]phenyl]-3-(4,4-dimethylpentyl)urea |
|---|---|
| PubChem CID | 91183730 |
| Molecular Formula | C31H44N6O3 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | 1-[4-[7-acetyl-4-(3-methylmorpholin-4-yl)-8-prop-2-enyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]phenyl]-3-(4,4-dimethylpentyl)urea |
| SMILES | C=CCC1c2nc(-c3ccc(NC(=O)NCCCC(C)(C)C)cc3)nc(N3CCOCC3C)c2CCN1C(C)=O |
| InChI | InChI=1S/C31H44N6O3/c1-7-9-26-27-25(14-17-37(26)22(3)38)29(36-18-19-40-20-21(36)2)35-28(34-27)23-10-12-24(13-11-23)33-30(39)32-16-8-15-31(4,5)6/h7,10-13,21,26H,1,8-9,14-20H2,2-6H3,(H2,32,33,39) |
| InChIKey | RJOPHWBIVDRCIY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|