C16H19BN2O5S — CID 91183789
CID 91183789 (PubChem CID 91183789) has the molecular formula C16H19BN2O5S and a molecular weight of 362.22 g/mol.
| Compound Name | CID 91183789 |
|---|---|
| PubChem CID | 91183789 |
| Molecular Formula | C16H19BN2O5S |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N(C)CCCOc1cc(Cc2sc(=O)[nH]c2O)ccc1OC |
| InChI | InChI=1S/C16H19BN2O5S/c1-19(15(17)21)6-3-7-24-12-8-10(4-5-11(12)23-2)9-13-14(20)18-16(22)25-13/h4-5,8,20H,3,6-7,9H2,1-2H3,(H,18,22) |
| InChIKey | HPXCIRJSTQLYLE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|