About 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol
1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol (PubChem CID 91184311) has the molecular formula C21H21F2NO3
and a molecular weight of 373.40 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol |
| PubChem CID | 91184311 |
| Molecular Formula | C21H21F2NO3 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol |
| SMILES | COc1ccc(CCCc2cc(O)n(Cc3cc(F)cc(F)c3)c2O)cc1 |
| InChI | InChI=1S/C21H21F2NO3/c1-27-19-7-5-14(6-8-19)3-2-4-16-11-20(25)24(21(16)26)13-15-9-17(22)12-18(23)10-15/h5-12,25-26H,2-4,13H2,1H3 |
| InChIKey | VETYYEAOBXSIQJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol?
The IUPAC name of 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol (CID 91184311) is 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol.
What is the SMILES notation for 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol?
The canonical SMILES for 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol is COc1ccc(CCCc2cc(O)n(Cc3cc(F)cc(F)c3)c2O)cc1.
What is the InChIKey of 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol?
The InChIKey is VETYYEAOBXSIQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F2NO3/c1-27-19-7-5-14(6-8-19)3-2-4-16-11-20(25)24(21(16)26)13-15-9-17(22)12-18(23)10-15/h5-12,25-26H,2-4,13H2,1H3.
What are the key properties of 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol?
1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol has a molecular weight of 373.40 g/mol, XLogP of 4.41, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-difluorophenyl)methyl]-3-[3-(4-methoxyphenyl)propyl]pyrrole-2,5-diol is sourced from PubChem (CID 91184311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).