C43H46N6O5S2 — CID 91184365
[2-[2-[7-(oxan-4-ylmethylamino)-5-phenoxy-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]acetyl] 2-[2-[7-(cyclopentylamino)-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]acetate (PubChem CID 91184365) has the molecular formula C43H46N6O5S2 and a molecular weight of 791.01 g/mol. Its IUPAC name is [2-[2-[7-(oxan-4-ylmethylamino)-5-phenoxy-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]acetyl] 2-[2-[7-(cyclopentylamino)-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]acetate.
| Compound Name | [2-[2-[7-(oxan-4-ylmethylamino)-5-phenoxy-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]acetyl] 2-[2-[7-(cyclopentylamino)-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 91184365 |
| Molecular Formula | C43H46N6O5S2 |
| Molecular Weight | 791.01 g/mol |
| Exact Mass | 790.30 |
| IUPAC Name | [2-[2-[7-(oxan-4-ylmethylamino)-5-phenoxy-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]acetyl] 2-[2-[7-(cyclopentylamino)-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]acetate |
| SMILES | O=C(CC1CSC(c2cc3cc(Oc4ccccc4)cc(NCC4CCOCC4)c3[nH]2)=N1)OC(=O)CC1CSC(c2cc3cccc(NC4CCCC4)c3[nH]2)=N1 |
| InChI | InChI=1S/C43H46N6O5S2/c50-38(20-30-24-55-42(46-30)36-18-27-7-6-12-34(40(27)48-36)45-29-8-4-5-9-29)54-39(51)21-31-25-56-43(47-31)37-19-28-17-33(53-32-10-2-1-3-11-32)22-35(41(28)49-37)44-23-26-13-15-52-16-14-26/h1-3,6-7,10-12,17-19,22,26,29-31,44-45,48-49H,4-5,8-9,13-16,20-21,23-25H2 |
| InChIKey | JDUMUOKTVHHNIB-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.01 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|