C11H18O4 — CID 91184436
spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-ylmethanol (PubChem CID 91184436) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-ylmethanol.
| Compound Name | spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-ylmethanol |
|---|---|
| PubChem CID | 91184436 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-ylmethanol |
| SMILES | OCC1OCC2OC3(CCCCC3)OC12 |
| InChI | InChI=1S/C11H18O4/c12-6-8-10-9(7-13-8)14-11(15-10)4-2-1-3-5-11/h8-10,12H,1-7H2 |
| InChIKey | MVGQKFNELWQDHC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |