C26H25FN4O9S — CID 91184463
(4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(pyridin-3-ylsulfonylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91184463) has the molecular formula C26H25FN4O9S and a molecular weight of 588.57 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(pyridin-3-ylsulfonylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(pyridin-3-ylsulfonylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91184463 |
| Molecular Formula | C26H25FN4O9S |
| Molecular Weight | 588.57 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-(pyridin-3-ylsulfonylamino)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(NS(=O)(=O)c5cccnc5)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H25FN4O9S/c1-31(2)19-13-7-10-6-12-14(27)8-15(30-41(39,40)11-4-3-5-29-9-11)20(32)17(12)21(33)16(10)23(35)26(13,38)24(36)18(22(19)34)25(28)37/h3-5,8-10,13,16,18-19,30,32,38H,6-7H2,1-2H3,(H2,28,37)/t10-,13-,16?,18?,19-,26-/m0/s1 |
| InChIKey | JZDNIKBOVYOCRN-PACCZPJQSA-N |
| XLogP | -0.80 |
| TPSA | 214.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.57 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|