C28H42FN3O2S — CID 91185052
(2S)-N-[5-(6-ethoxy-6-methylheptan-2-yl)-1,3-thiazol-2-yl]-2-[(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)amino]pentanamide (PubChem CID 91185052) has the molecular formula C28H42FN3O2S and a molecular weight of 503.73 g/mol. Its IUPAC name is (2S)-N-[5-(6-ethoxy-6-methylheptan-2-yl)-1,3-thiazol-2-yl]-2-[(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)amino]pentanamide.
| Compound Name | (2S)-N-[5-(6-ethoxy-6-methylheptan-2-yl)-1,3-thiazol-2-yl]-2-[(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)amino]pentanamide |
|---|---|
| PubChem CID | 91185052 |
| Molecular Formula | C28H42FN3O2S |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | (2S)-N-[5-(6-ethoxy-6-methylheptan-2-yl)-1,3-thiazol-2-yl]-2-[(8-fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)amino]pentanamide |
| SMILES | CCC[C@H](NC1CCc2cccc(F)c2C1)C(=O)Nc1ncc(C(C)CCCC(C)(C)OCC)s1 |
| InChI | InChI=1S/C28H42FN3O2S/c1-6-10-24(31-21-15-14-20-12-8-13-23(29)22(20)17-21)26(33)32-27-30-18-25(35-27)19(3)11-9-16-28(4,5)34-7-2/h8,12-13,18-19,21,24,31H,6-7,9-11,14-17H2,1-5H3,(H,30,32,33)/t19?,21?,24-/m0/s1 |
| InChIKey | IZPCMWPZGMLQDZ-HQOBLLPJSA-N |
| XLogP | 6.63 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |