C28H36F2O5S — CID 91185218
[3-(3,4-difluorophenyl)-4-hydroxy-2-(4-methylsulfonylphenyl)but-2-enyl] (2R)-2-propyloctanoate (PubChem CID 91185218) has the molecular formula C28H36F2O5S and a molecular weight of 522.65 g/mol. Its IUPAC name is [3-(3,4-difluorophenyl)-4-hydroxy-2-(4-methylsulfonylphenyl)but-2-enyl] (2R)-2-propyloctanoate.
| Compound Name | [3-(3,4-difluorophenyl)-4-hydroxy-2-(4-methylsulfonylphenyl)but-2-enyl] (2R)-2-propyloctanoate |
|---|---|
| PubChem CID | 91185218 |
| Molecular Formula | C28H36F2O5S |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | [3-(3,4-difluorophenyl)-4-hydroxy-2-(4-methylsulfonylphenyl)but-2-enyl] (2R)-2-propyloctanoate |
| SMILES | CCCCCC[C@@H](CCC)C(=O)OCC(=C(CO)c1ccc(F)c(F)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H36F2O5S/c1-4-6-7-8-10-21(9-5-2)28(32)35-19-25(20-11-14-23(15-12-20)36(3,33)34)24(18-31)22-13-16-26(29)27(30)17-22/h11-17,21,31H,4-10,18-19H2,1-3H3/t21-/m1/s1 |
| InChIKey | GNFSRODPMYETLZ-OAQYLSRUSA-N |
| XLogP | 6.20 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|