C30H48NO5Si4- — CID 91185256
[1-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]-1-oxo-5,5-diphenylpenta-2,4-dien-2-yl]-methylazanide (PubChem CID 91185256) has the molecular formula C30H48NO5Si4- and a molecular weight of 615.06 g/mol. Its IUPAC name is [1-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]-1-oxo-5,5-diphenylpenta-2,4-dien-2-yl]-methylazanide.
| Compound Name | [1-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]-1-oxo-5,5-diphenylpenta-2,4-dien-2-yl]-methylazanide |
|---|---|
| PubChem CID | 91185256 |
| Molecular Formula | C30H48NO5Si4- |
| Molecular Weight | 615.06 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | [1-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]-1-oxo-5,5-diphenylpenta-2,4-dien-2-yl]-methylazanide |
| SMILES | C[N-]C(=CC=C(c1ccccc1)c1ccccc1)C(=O)OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C30H48NO5Si4/c1-31-29(23-22-28(26-18-13-11-14-19-26)27-20-15-12-16-21-27)30(32)33-24-17-25-40(10,35-38(5,6)7)36-39(8,9)34-37(2,3)4/h11-16,18-23H,17,24-25H2,1-10H3/q-1 |
| InChIKey | FKGCYLJRYBFNIM-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.06 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|