About 1,5-dimethylideneanthracene-9,10-diol
1,5-dimethylideneanthracene-9,10-diol (PubChem CID 91185500) has the molecular formula C16H12O2
and a molecular weight of 236.27 g/mol. Its IUPAC name is 1,5-dimethylideneanthracene-9,10-diol.
Molecular Properties
| Compound Name | 1,5-dimethylideneanthracene-9,10-diol |
| PubChem CID | 91185500 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1,5-dimethylideneanthracene-9,10-diol |
| SMILES | C=c1cccc2c(O)c3c(=C)cccc3c(O)c12 |
| InChI | InChI=1S/C16H12O2/c1-9-5-3-7-11-13(9)15(17)12-8-4-6-10(2)14(12)16(11)18/h3-8,17-18H,1-2H2 |
| InChIKey | HPUPPLOKUSBQNE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dimethylideneanthracene-9,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethylideneanthracene-9,10-diol?
The IUPAC name of 1,5-dimethylideneanthracene-9,10-diol (CID 91185500) is 1,5-dimethylideneanthracene-9,10-diol.
What is the SMILES notation for 1,5-dimethylideneanthracene-9,10-diol?
The canonical SMILES for 1,5-dimethylideneanthracene-9,10-diol is C=c1cccc2c(O)c3c(=C)cccc3c(O)c12.
What is the InChIKey of 1,5-dimethylideneanthracene-9,10-diol?
The InChIKey is HPUPPLOKUSBQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O2/c1-9-5-3-7-11-13(9)15(17)12-8-4-6-10(2)14(12)16(11)18/h3-8,17-18H,1-2H2.
What are the key properties of 1,5-dimethylideneanthracene-9,10-diol?
1,5-dimethylideneanthracene-9,10-diol has a molecular weight of 236.27 g/mol, XLogP of 2.22, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylideneanthracene-9,10-diol is sourced from PubChem (CID 91185500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).