About 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium
3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium (PubChem CID 91185648) has the molecular formula C7H13N2+
and a molecular weight of 125.19 g/mol. Its IUPAC name is 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium.
Molecular Properties
| Compound Name | 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium |
| PubChem CID | 91185648 |
| Molecular Formula | C7H13N2+ |
| Molecular Weight | 125.19 g/mol |
| Exact Mass | 125.11 |
| IUPAC Name | 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium |
| SMILES | CC=C(C)[N+]1=CNCC1 |
| InChI | InChI=1S/C7H12N2/c1-3-7(2)9-5-4-8-6-9/h3,6H,4-5H2,1-2H3/p+1 |
| InChIKey | VCPVJUQCKQQDPD-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium?
The IUPAC name of 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium (CID 91185648) is 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium.
What is the SMILES notation for 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium?
The canonical SMILES for 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium is CC=C(C)[N+]1=CNCC1.
What is the InChIKey of 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium?
The InChIKey is VCPVJUQCKQQDPD-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H12N2/c1-3-7(2)9-5-4-8-6-9/h3,6H,4-5H2,1-2H3/p+1.
What are the key properties of 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium?
3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium has a molecular weight of 125.19 g/mol, XLogP of 0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-en-2-yl-4,5-dihydro-1H-imidazol-3-ium is sourced from PubChem (CID 91185648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).