C15H20N2O4 — CID 91185825
diethyl 2-[(2,6-dimethyl-3-pyridinyl)iminomethyl]propanedioate (PubChem CID 91185825) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is diethyl 2-[(2,6-dimethyl-3-pyridinyl)iminomethyl]propanedioate.
| Compound Name | diethyl 2-[(2,6-dimethyl-3-pyridinyl)iminomethyl]propanedioate |
|---|---|
| PubChem CID | 91185825 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | diethyl 2-[(2,6-dimethyl-3-pyridinyl)iminomethyl]propanedioate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(C)nc1C)C(=O)OCC |
| InChI | InChI=1S/C15H20N2O4/c1-5-20-14(18)12(15(19)21-6-2)9-16-13-8-7-10(3)17-11(13)4/h7-9,12H,5-6H2,1-4H3/b16-9+ |
| InChIKey | ZOZAPNGFMSUSQM-CXUHLZMHSA-N |
| XLogP | 2.14 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|