C8H10N2O — CID 91185885
3,5,6,8a-tetrahydro-1H-1,8-naphthyridin-2-one (PubChem CID 91185885) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 3,5,6,8a-tetrahydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 3,5,6,8a-tetrahydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 91185885 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3,5,6,8a-tetrahydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CC=C2CCC=NC2N1 |
| InChI | InChI=1S/C8H10N2O/c11-7-4-3-6-2-1-5-9-8(6)10-7/h3,5,8H,1-2,4H2,(H,10,11) |
| InChIKey | OCGKXXRYTYUYNB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|