About 2-dodecyl-3,4,5-triiminocyclopentan-1-amine
2-dodecyl-3,4,5-triiminocyclopentan-1-amine (PubChem CID 91186532) has the molecular formula C17H32N4
and a molecular weight of 292.47 g/mol. Its IUPAC name is 2-dodecyl-3,4,5-triiminocyclopentan-1-amine.
Molecular Properties
| Compound Name | 2-dodecyl-3,4,5-triiminocyclopentan-1-amine |
| PubChem CID | 91186532 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 2-dodecyl-3,4,5-triiminocyclopentan-1-amine |
| SMILES | [H]/N=C1C(=N\[H])\C(=N/[H])C(CCCCCCCCCCCC)C\1N |
| InChI | InChI=1S/C17H32N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(18)16(20)17(21)15(13)19/h13-14,19-21H,2-12,18H2,1H3/b19-15-,20-16-,21-17+ |
| InChIKey | LBABBJCYKVPSGZ-UDMMPXBHSA-N |
| XLogP | 4.31 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecyl-3,4,5-triiminocyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecyl-3,4,5-triiminocyclopentan-1-amine?
The IUPAC name of 2-dodecyl-3,4,5-triiminocyclopentan-1-amine (CID 91186532) is 2-dodecyl-3,4,5-triiminocyclopentan-1-amine.
What is the SMILES notation for 2-dodecyl-3,4,5-triiminocyclopentan-1-amine?
The canonical SMILES for 2-dodecyl-3,4,5-triiminocyclopentan-1-amine is [H]/N=C1C(=N\[H])\C(=N/[H])C(CCCCCCCCCCCC)C\1N.
What is the InChIKey of 2-dodecyl-3,4,5-triiminocyclopentan-1-amine?
The InChIKey is LBABBJCYKVPSGZ-UDMMPXBHSA-N. The full InChI is InChI=1S/C17H32N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(18)16(20)17(21)15(13)19/h13-14,19-21H,2-12,18H2,1H3/b19-15-,20-16-,21-17+.
What are the key properties of 2-dodecyl-3,4,5-triiminocyclopentan-1-amine?
2-dodecyl-3,4,5-triiminocyclopentan-1-amine has a molecular weight of 292.47 g/mol, XLogP of 4.31, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecyl-3,4,5-triiminocyclopentan-1-amine is sourced from PubChem (CID 91186532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).