About 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione
4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione (PubChem CID 91187102) has the molecular formula C24H22N4O2
and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione.
Molecular Properties
| Compound Name | 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione |
| PubChem CID | 91187102 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione |
| SMILES | CCCn1c(=O)c2c([nH]c3cc(-c4ccccc4)cn32)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C24H22N4O2/c1-2-13-26-23(29)21-22(28(24(26)30)15-17-9-5-3-6-10-17)25-20-14-19(16-27(20)21)18-11-7-4-8-12-18/h3-12,14,16,25H,2,13,15H2,1H3 |
| InChIKey | BFCQQDMFXUQJSL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione?
The IUPAC name of 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione (CID 91187102) is 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione.
What is the SMILES notation for 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione?
The canonical SMILES for 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione is CCCn1c(=O)c2c([nH]c3cc(-c4ccccc4)cn32)n(Cc2ccccc2)c1=O.
What is the InChIKey of 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione?
The InChIKey is BFCQQDMFXUQJSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O2/c1-2-13-26-23(29)21-22(28(24(26)30)15-17-9-5-3-6-10-17)25-20-14-19(16-27(20)21)18-11-7-4-8-12-18/h3-12,14,16,25H,2,13,15H2,1H3.
What are the key properties of 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione?
4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione has a molecular weight of 398.47 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-7-phenyl-2-propyl-5H-purino[7,8-a]pyrrole-1,3-dione is sourced from PubChem (CID 91187102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).