C36H37N2O6+ — CID 91187544
7-(4-tert-butylphenoxy)-2-[[2-carboxy-2-(4-phenylphenyl)ethyl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylic acid (PubChem CID 91187544) has the molecular formula C36H37N2O6+ and a molecular weight of 593.70 g/mol. Its IUPAC name is 7-(4-tert-butylphenoxy)-2-[[2-carboxy-2-(4-phenylphenyl)ethyl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylic acid.
| Compound Name | 7-(4-tert-butylphenoxy)-2-[[2-carboxy-2-(4-phenylphenyl)ethyl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 91187544 |
| Molecular Formula | C36H37N2O6+ |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 7-(4-tert-butylphenoxy)-2-[[2-carboxy-2-(4-phenylphenyl)ethyl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(Oc2ccc3c(c2)C[N+](C(=O)O)(C(=O)NCC(C(=O)O)c2ccc(-c4ccccc4)cc2)CC3)cc1 |
| InChI | InChI=1S/C36H36N2O6/c1-36(2,3)29-14-17-30(18-15-29)44-31-16-13-26-19-20-38(35(42)43,23-28(26)21-31)34(41)37-22-32(33(39)40)27-11-9-25(10-12-27)24-7-5-4-6-8-24/h4-18,21,32H,19-20,22-23H2,1-3H3,(H2-,37,39,40,41,42,43)/p+1 |
| InChIKey | HQUOLSLBOWQTFL-UHFFFAOYSA-O |
| XLogP | 7.57 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|