C32H49NO5 — CID 91187583
(2,5-dihydroxypyrrol-1-yl) [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate (PubChem CID 91187583) has the molecular formula C32H49NO5 and a molecular weight of 527.75 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
|---|---|
| PubChem CID | 91187583 |
| Molecular Formula | C32H49NO5 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] carbonate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)On5c(O)ccc5O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C32H49NO5/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(37-30(36)38-33-28(34)13-14-29(33)35)15-17-31(22,4)27(24)16-18-32(25,26)5/h9,13-14,20-21,23-27,34-35H,6-8,10-12,15-19H2,1-5H3 |
| InChIKey | YIJLWRPPVXITGI-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|