C13H11ClF3N3O — CID 91188299
4-chloro-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-8-one (PubChem CID 91188299) has the molecular formula C13H11ClF3N3O and a molecular weight of 317.70 g/mol. Its IUPAC name is 4-chloro-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-8-one.
| Compound Name | 4-chloro-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-8-one |
|---|---|
| PubChem CID | 91188299 |
| Molecular Formula | C13H11ClF3N3O |
| Molecular Weight | 317.70 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-chloro-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-8-one |
| SMILES | O=C1CCc2cc(Cl)c3[nH]ncc3c2CN1CC(F)(F)F |
| InChI | InChI=1S/C13H11ClF3N3O/c14-10-3-7-1-2-11(21)20(6-13(15,16)17)5-9(7)8-4-18-19-12(8)10/h3-4H,1-2,5-6H2,(H,18,19) |
| InChIKey | IZIQCCWYMAFWMR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |