About (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene
(1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene (PubChem CID 91188469) has the molecular formula C20H22
and a molecular weight of 262.40 g/mol. Its IUPAC name is (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene |
| PubChem CID | 91188469 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene |
| SMILES | c1ccc2c(c1)CC[C@@H]2CCc1cccc2c1CCC2 |
| InChI | InChI=1S/C20H22/c1-2-9-19-16(5-1)11-13-18(19)14-12-17-7-3-6-15-8-4-10-20(15)17/h1-3,5-7,9,18H,4,8,10-14H2/t18-/m1/s1 |
| InChIKey | PZVBZBYENZIOHX-GOSISDBHSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene?
The IUPAC name of (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene (CID 91188469) is (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene.
What is the SMILES notation for (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene?
The canonical SMILES for (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene is c1ccc2c(c1)CC[C@@H]2CCc1cccc2c1CCC2.
What is the InChIKey of (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene?
The InChIKey is PZVBZBYENZIOHX-GOSISDBHSA-N. The full InChI is InChI=1S/C20H22/c1-2-9-19-16(5-1)11-13-18(19)14-12-17-7-3-6-15-8-4-10-20(15)17/h1-3,5-7,9,18H,4,8,10-14H2/t18-/m1/s1.
What are the key properties of (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene?
(1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene has a molecular weight of 262.40 g/mol, XLogP of 4.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[2-(2,3-dihydro-1H-inden-4-yl)ethyl]-2,3-dihydro-1H-indene is sourced from PubChem (CID 91188469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).