1,3-dimethylpiperidine-2-carboxylic acid

C8H15NO2 — CID 91188555

IUPAC1,3-dimethylpiperidine-2-carboxylic acid
SMILESCC1CCCN(C)C1C(=O)O
InChIInChI=1S/C8H15NO2/c1-6-4-3-5-9(2)7(6)8(10)11/h6-7H,3-5H2,1-2H3,(H,10,11)
InChIKeyVTTHLLTXRBAJTF-UHFFFAOYSA-N
MW157.21 g/mol
LogP0.80
Rot. Bonds1

About 1,3-dimethylpiperidine-2-carboxylic acid

1,3-dimethylpiperidine-2-carboxylic acid (PubChem CID 91188555) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 1,3-dimethylpiperidine-2-carboxylic acid.

Molecular Properties

Compound Name1,3-dimethylpiperidine-2-carboxylic acid
PubChem CID91188555
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Name1,3-dimethylpiperidine-2-carboxylic acid
SMILESCC1CCCN(C)C1C(=O)O
InChIInChI=1S/C8H15NO2/c1-6-4-3-5-9(2)7(6)8(10)11/h6-7H,3-5H2,1-2H3,(H,10,11)
InChIKeyVTTHLLTXRBAJTF-UHFFFAOYSA-N
XLogP0.80
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1,3-dimethylpiperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethylpiperidine-2-carboxylic acid?
The IUPAC name of 1,3-dimethylpiperidine-2-carboxylic acid (CID 91188555) is 1,3-dimethylpiperidine-2-carboxylic acid.
What is the SMILES notation for 1,3-dimethylpiperidine-2-carboxylic acid?
The canonical SMILES for 1,3-dimethylpiperidine-2-carboxylic acid is CC1CCCN(C)C1C(=O)O.
What is the InChIKey of 1,3-dimethylpiperidine-2-carboxylic acid?
The InChIKey is VTTHLLTXRBAJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-6-4-3-5-9(2)7(6)8(10)11/h6-7H,3-5H2,1-2H3,(H,10,11).
What are the key properties of 1,3-dimethylpiperidine-2-carboxylic acid?
1,3-dimethylpiperidine-2-carboxylic acid has a molecular weight of 157.21 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpiperidine-2-carboxylic acid is sourced from PubChem (CID 91188555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).