C20H16F3N3O2 — CID 91188580
1-(3H-benzimidazol-5-yl)-4-propan-2-yl-5-(2,3,5-trifluorophenyl)pyrrole-2,3-diol (PubChem CID 91188580) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-4-propan-2-yl-5-(2,3,5-trifluorophenyl)pyrrole-2,3-diol.
| Compound Name | 1-(3H-benzimidazol-5-yl)-4-propan-2-yl-5-(2,3,5-trifluorophenyl)pyrrole-2,3-diol |
|---|---|
| PubChem CID | 91188580 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-4-propan-2-yl-5-(2,3,5-trifluorophenyl)pyrrole-2,3-diol |
| SMILES | CC(C)c1c(O)c(O)n(-c2ccc3nc[nH]c3c2)c1-c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C20H16F3N3O2/c1-9(2)16-18(12-5-10(21)6-13(22)17(12)23)26(20(28)19(16)27)11-3-4-14-15(7-11)25-8-24-14/h3-9,27-28H,1-2H3,(H,24,25) |
| InChIKey | DXDNHQOSYWPZGU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|