C9H12N2O3 — CID 91188626
3-amino-N-(2,3-dihydroxyphenyl)propanamide (PubChem CID 91188626) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-amino-N-(2,3-dihydroxyphenyl)propanamide.
| Compound Name | 3-amino-N-(2,3-dihydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 91188626 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 3-amino-N-(2,3-dihydroxyphenyl)propanamide |
| SMILES | NCCC(=O)Nc1cccc(O)c1O |
| InChI | InChI=1S/C9H12N2O3/c10-5-4-8(13)11-6-2-1-3-7(12)9(6)14/h1-3,12,14H,4-5,10H2,(H,11,13) |
| InChIKey | SLRUJMOTVGRWRS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|