C24H40O4 — CID 91188692
(2R,3S,4S,6R,7R,14R)-4-but-1-enyl-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one (PubChem CID 91188692) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is (2R,3S,4S,6R,7R,14R)-4-but-1-enyl-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one.
| Compound Name | (2R,3S,4S,6R,7R,14R)-4-but-1-enyl-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one |
|---|---|
| PubChem CID | 91188692 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | (2R,3S,4S,6R,7R,14R)-4-but-1-enyl-6-hydroxy-3-(methoxymethoxy)-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one |
| SMILES | CCC=C[C@]1(C)C[C@@H](O)[C@@]2(C)C3C(=O)CCC3(CC[C@H]2C)[C@@H](C)[C@@H]1OCOC |
| InChI | InChI=1S/C24H40O4/c1-7-8-11-22(4)14-19(26)23(5)16(2)9-12-24(13-10-18(25)20(23)24)17(3)21(22)28-15-27-6/h8,11,16-17,19-21,26H,7,9-10,12-15H2,1-6H3/t16-,17+,19-,20?,21+,22-,23+,24?/m1/s1 |
| InChIKey | USZKTDQXDQRZTI-UGTSRKROSA-N |
| XLogP | 4.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|