C15H14F2N2 — CID 91189528
3-(3,4-difluorophenyl)-1-methyl-1,4,5,8-tetrahydro-2,7-naphthyridine (PubChem CID 91189528) has the molecular formula C15H14F2N2 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-1-methyl-1,4,5,8-tetrahydro-2,7-naphthyridine.
| Compound Name | 3-(3,4-difluorophenyl)-1-methyl-1,4,5,8-tetrahydro-2,7-naphthyridine |
|---|---|
| PubChem CID | 91189528 |
| Molecular Formula | C15H14F2N2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-(3,4-difluorophenyl)-1-methyl-1,4,5,8-tetrahydro-2,7-naphthyridine |
| SMILES | CC1N=C(c2ccc(F)c(F)c2)CC2=C1CN=CC2 |
| InChI | InChI=1S/C15H14F2N2/c1-9-12-8-18-5-4-10(12)7-15(19-9)11-2-3-13(16)14(17)6-11/h2-3,5-6,9H,4,7-8H2,1H3 |
| InChIKey | ZUKHUDFHVRICPU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|