C20H29N3O5 — CID 91190239
prop-2-enyl (6S,6aS)-3-(3-aminopropoxy)-6-hydroxy-2-methoxy-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 91190239) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is prop-2-enyl (6S,6aS)-3-(3-aminopropoxy)-6-hydroxy-2-methoxy-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | prop-2-enyl (6S,6aS)-3-(3-aminopropoxy)-6-hydroxy-2-methoxy-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 91190239 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | prop-2-enyl (6S,6aS)-3-(3-aminopropoxy)-6-hydroxy-2-methoxy-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | C=CCOC(=O)N1c2cc(OCCCN)c(OC)cc2CN2CCC[C@H]2[C@@H]1O |
| InChI | InChI=1S/C20H29N3O5/c1-3-9-28-20(25)23-16-12-18(27-10-5-7-21)17(26-2)11-14(16)13-22-8-4-6-15(22)19(23)24/h3,11-12,15,19,24H,1,4-10,13,21H2,2H3/t15-,19-/m0/s1 |
| InChIKey | NEUFTULXQNVUPG-KXBFYZLASA-N |
| XLogP | 1.85 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|