C23H21N3O4 — CID 9119047
4-[(E)-3-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzonitrile (PubChem CID 9119047) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 4-[(E)-3-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzonitrile.
| Compound Name | 4-[(E)-3-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 9119047 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-[(E)-3-[4-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]piperazin-1-yl]-3-oxoprop-1-enyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/C(=O)N2CCN(C(=O)[C@@H]3COc4ccccc4O3)CC2)cc1 |
| InChI | InChI=1S/C23H21N3O4/c24-15-18-7-5-17(6-8-18)9-10-22(27)25-11-13-26(14-12-25)23(28)21-16-29-19-3-1-2-4-20(19)30-21/h1-10,21H,11-14,16H2/b10-9+/t21-/m0/s1 |
| InChIKey | XDDPPRWJRUHFNV-GLCJEOIMSA-N |
| XLogP | 2.08 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|