About 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine
3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine (PubChem CID 91190524) has the molecular formula C16H23Cl2N
and a molecular weight of 300.27 g/mol. Its IUPAC name is 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine |
| PubChem CID | 91190524 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine |
| SMILES | CCCCC1(c2ccc(Cl)c(Cl)c2)CN(C)CC1C |
| InChI | InChI=1S/C16H23Cl2N/c1-4-5-8-16(11-19(3)10-12(16)2)13-6-7-14(17)15(18)9-13/h6-7,9,12H,4-5,8,10-11H2,1-3H3 |
| InChIKey | VRBVTUUEKOMPFD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine?
The IUPAC name of 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine (CID 91190524) is 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine.
What is the SMILES notation for 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine?
The canonical SMILES for 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine is CCCCC1(c2ccc(Cl)c(Cl)c2)CN(C)CC1C.
What is the InChIKey of 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine?
The InChIKey is VRBVTUUEKOMPFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl2N/c1-4-5-8-16(11-19(3)10-12(16)2)13-6-7-14(17)15(18)9-13/h6-7,9,12H,4-5,8,10-11H2,1-3H3.
What are the key properties of 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine?
3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine has a molecular weight of 300.27 g/mol, XLogP of 5.00, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-3-(3,4-dichlorophenyl)-1,4-dimethylpyrrolidine is sourced from PubChem (CID 91190524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).