C12H13N3O4 — CID 91190636
N-hydroxy-4-oxospiro[6H-pyrimido[2,1-c][1,4]oxazepine-10,1'-cyclobutane]-2-carboxamide (PubChem CID 91190636) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is N-hydroxy-4-oxospiro[6H-pyrimido[2,1-c][1,4]oxazepine-10,1'-cyclobutane]-2-carboxamide.
| Compound Name | N-hydroxy-4-oxospiro[6H-pyrimido[2,1-c][1,4]oxazepine-10,1'-cyclobutane]-2-carboxamide |
|---|---|
| PubChem CID | 91190636 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-hydroxy-4-oxospiro[6H-pyrimido[2,1-c][1,4]oxazepine-10,1'-cyclobutane]-2-carboxamide |
| SMILES | O=C(NO)c1cc(=O)n2c(n1)C1(CCC1)OC=CC2 |
| InChI | InChI=1S/C12H13N3O4/c16-9-7-8(10(17)14-18)13-11-12(3-1-4-12)19-6-2-5-15(9)11/h2,6-7,18H,1,3-5H2,(H,14,17) |
| InChIKey | BPVSTMDVQYKWOL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|