About 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene
1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene (PubChem CID 91190808) has the molecular formula C10H16F4O
and a molecular weight of 228.23 g/mol. Its IUPAC name is 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene.
Molecular Properties
| Compound Name | 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene |
| PubChem CID | 91190808 |
| Molecular Formula | C10H16F4O |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene |
| SMILES | C=C(C)OC(C)(C)CF.CC(F)=C(F)F |
| InChI | InChI=1S/C7H13FO.C3H3F3/c1-6(2)9-7(3,4)5-8;1-2(4)3(5)6/h1,5H2,2-4H3;1H3 |
| InChIKey | UHRXOVAUZQNLHY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene?
The IUPAC name of 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene (CID 91190808) is 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene.
What is the SMILES notation for 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene?
The canonical SMILES for 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene is C=C(C)OC(C)(C)CF.CC(F)=C(F)F.
What is the InChIKey of 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene?
The InChIKey is UHRXOVAUZQNLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FO.C3H3F3/c1-6(2)9-7(3,4)5-8;1-2(4)3(5)6/h1,5H2,2-4H3;1H3.
What are the key properties of 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene?
1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene has a molecular weight of 228.23 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-methyl-2-prop-1-en-2-yloxypropane;1,1,2-trifluoroprop-1-ene is sourced from PubChem (CID 91190808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).