C26H18F6S2 — CID 91190987
3-[2-(2,4-dimethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophene (PubChem CID 91190987) has the molecular formula C26H18F6S2 and a molecular weight of 508.55 g/mol. Its IUPAC name is 3-[2-(2,4-dimethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophene.
| Compound Name | 3-[2-(2,4-dimethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 91190987 |
| Molecular Formula | C26H18F6S2 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 3-[2-(2,4-dimethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophene |
| SMILES | Cc1sc(-c2ccccc2)c(C)c1C1=C(c2c(C)sc3ccccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C26H18F6S2/c1-13-19(14(2)34-23(13)16-9-5-4-6-10-16)21-22(25(29,30)26(31,32)24(21,27)28)20-15(3)33-18-12-8-7-11-17(18)20/h4-12H,1-3H3 |
| InChIKey | OHDLUNDNJIKRIO-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|