C16H15F3N4O5S — CID 91191790
(2R)-4-pyrimidin-4-yl-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-2-carboxylic acid (PubChem CID 91191790) has the molecular formula C16H15F3N4O5S and a molecular weight of 432.38 g/mol. Its IUPAC name is (2R)-4-pyrimidin-4-yl-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-2-carboxylic acid.
| Compound Name | (2R)-4-pyrimidin-4-yl-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 91191790 |
| Molecular Formula | C16H15F3N4O5S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (2R)-4-pyrimidin-4-yl-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(c2ccncn2)CCN1S(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3N4O5S/c17-16(18,19)28-11-1-3-12(4-2-11)29(26,27)23-8-7-22(9-13(23)15(24)25)14-5-6-20-10-21-14/h1-6,10,13H,7-9H2,(H,24,25)/t13-/m1/s1 |
| InChIKey | HYGXJEKLJNSRBF-CYBMUJFWSA-N |
| XLogP | 1.34 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |