C19H17Cl2N3O3 — CID 91192136
(4R,7S)-2-[4-(4,5-dichloroimidazol-1-yl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol (PubChem CID 91192136) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is (4R,7S)-2-[4-(4,5-dichloroimidazol-1-yl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol.
| Compound Name | (4R,7S)-2-[4-(4,5-dichloroimidazol-1-yl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 91192136 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (4R,7S)-2-[4-(4,5-dichloroimidazol-1-yl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3-diol |
| SMILES | C[C@]12CC[C@](C)(O1)c1c2c(O)n(-c2ccc(-n3cnc(Cl)c3Cl)cc2)c1O |
| InChI | InChI=1S/C19H17Cl2N3O3/c1-18-7-8-19(2,27-18)13-12(18)16(25)24(17(13)26)11-5-3-10(4-6-11)23-9-22-14(20)15(23)21/h3-6,9,25-26H,7-8H2,1-2H3/t18-,19+ |
| InChIKey | ACIKCHROXCBIQW-KDURUIRLSA-N |
| XLogP | 4.64 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |