C11H16N8 — CID 91192288
N'-[2-(dimethylaminomethylideneamino)-7H-purin-6-yl]-N,N-dimethylmethanimidamide (PubChem CID 91192288) has the molecular formula C11H16N8 and a molecular weight of 260.31 g/mol. Its IUPAC name is N'-[2-(dimethylaminomethylideneamino)-7H-purin-6-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[2-(dimethylaminomethylideneamino)-7H-purin-6-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 91192288 |
| Molecular Formula | C11H16N8 |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N'-[2-(dimethylaminomethylideneamino)-7H-purin-6-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1nc(/N=C/N(C)C)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H16N8/c1-18(2)6-14-10-8-9(13-5-12-8)16-11(17-10)15-7-19(3)4/h5-7H,1-4H3,(H,12,13,16,17)/b14-6+,15-7? |
| InChIKey | ABOTUYYAJWRINP-HOLUKEDKSA-N |
| XLogP | 0.80 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|