C25H29N5O — CID 91192359
3-[[(2R,6S)-2,6-bis(3-methyl-2-pyridinyl)piperidin-1-yl]methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 91192359) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-[[(2R,6S)-2,6-bis(3-methyl-2-pyridinyl)piperidin-1-yl]methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-[[(2R,6S)-2,6-bis(3-methyl-2-pyridinyl)piperidin-1-yl]methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 91192359 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 3-[[(2R,6S)-2,6-bis(3-methyl-2-pyridinyl)piperidin-1-yl]methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1cccnc1[C@H]1CCC[C@@H](c2ncccc2C)N1Cc1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C25H29N5O/c1-17-7-5-13-27-23(17)21-11-4-12-22(24-18(2)8-6-14-28-24)30(21)16-19-9-3-10-20(15-19)25(26)29-31/h3,5-10,13-15,21-22,31H,4,11-12,16H2,1-2H3,(H2,26,29)/t21-,22+ |
| InChIKey | FONWGHGWRFERMB-SZPZYZBQSA-N |
| XLogP | 4.66 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|