About 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one
5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 91192546) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one.
Molecular Properties
| Compound Name | 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one |
| PubChem CID | 91192546 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | CN1C(=O)C2C3CCC(C3)C2C1O |
| InChI | InChI=1S/C10H15NO2/c1-11-9(12)7-5-2-3-6(4-5)8(7)10(11)13/h5-9,12H,2-4H2,1H3 |
| InChIKey | HAMVIRGEHCJJHS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one?
The IUPAC name of 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one (CID 91192546) is 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one.
What is the SMILES notation for 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one?
The canonical SMILES for 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one is CN1C(=O)C2C3CCC(C3)C2C1O.
What is the InChIKey of 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one?
The InChIKey is HAMVIRGEHCJJHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-11-9(12)7-5-2-3-6(4-5)8(7)10(11)13/h5-9,12H,2-4H2,1H3.
What are the key properties of 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one?
5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one has a molecular weight of 181.23 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-4-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one is sourced from PubChem (CID 91192546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).