About methanamine;1-methylpyrrole-2,5-dione;propan-2-one
methanamine;1-methylpyrrole-2,5-dione;propan-2-one (PubChem CID 91192658) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is methanamine;1-methylpyrrole-2,5-dione;propan-2-one.
Molecular Properties
| Compound Name | methanamine;1-methylpyrrole-2,5-dione;propan-2-one |
| PubChem CID | 91192658 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | methanamine;1-methylpyrrole-2,5-dione;propan-2-one |
| SMILES | CC(C)=O.CN.CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C5H5NO2.C3H6O.CH5N/c1-6-4(7)2-3-5(6)8;1-3(2)4;1-2/h2-3H,1H3;1-2H3;2H2,1H3 |
| InChIKey | FJAFMGZOLPKSQB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methanamine;1-methylpyrrole-2,5-dione;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-methylpyrrole-2,5-dione;propan-2-one?
The IUPAC name of methanamine;1-methylpyrrole-2,5-dione;propan-2-one (CID 91192658) is methanamine;1-methylpyrrole-2,5-dione;propan-2-one.
What is the SMILES notation for methanamine;1-methylpyrrole-2,5-dione;propan-2-one?
The canonical SMILES for methanamine;1-methylpyrrole-2,5-dione;propan-2-one is CC(C)=O.CN.CN1C(=O)C=CC1=O.
What is the InChIKey of methanamine;1-methylpyrrole-2,5-dione;propan-2-one?
The InChIKey is FJAFMGZOLPKSQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2.C3H6O.CH5N/c1-6-4(7)2-3-5(6)8;1-3(2)4;1-2/h2-3H,1H3;1-2H3;2H2,1H3.
What are the key properties of methanamine;1-methylpyrrole-2,5-dione;propan-2-one?
methanamine;1-methylpyrrole-2,5-dione;propan-2-one has a molecular weight of 200.24 g/mol, XLogP of -0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-methylpyrrole-2,5-dione;propan-2-one is sourced from PubChem (CID 91192658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).