About N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine
N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine (PubChem CID 91192667) has the molecular formula C20H28N2OS
and a molecular weight of 344.52 g/mol. Its IUPAC name is N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine.
Molecular Properties
| Compound Name | N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine |
| PubChem CID | 91192667 |
| Molecular Formula | C20H28N2OS |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine |
| SMILES | C#CC(CCC(C)CCC)=S(C)(=O)NC1=CCCc2cccnc21 |
| InChI | InChI=1S/C20H28N2OS/c1-5-9-16(3)13-14-18(6-2)24(4,23)22-19-12-7-10-17-11-8-15-21-20(17)19/h2,8,11-12,15-16H,5,7,9-10,13-14H2,1,3-4H3,(H,22,23) |
| InChIKey | FMFZQMGNGGWWRX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine?
The IUPAC name of N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine (CID 91192667) is N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine.
What is the SMILES notation for N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine?
The canonical SMILES for N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine is C#CC(CCC(C)CCC)=S(C)(=O)NC1=CCCc2cccnc21.
What is the InChIKey of N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine?
The InChIKey is FMFZQMGNGGWWRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2OS/c1-5-9-16(3)13-14-18(6-2)24(4,23)22-19-12-7-10-17-11-8-15-21-20(17)19/h2,8,11-12,15-16H,5,7,9-10,13-14H2,1,3-4H3,(H,22,23).
What are the key properties of N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine?
N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine has a molecular weight of 344.52 g/mol, XLogP of 3.81, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[methyl-(6-methylnon-1-yn-3-ylidene)-oxo-λ6-sulfanyl]-5,6-dihydroquinolin-8-amine is sourced from PubChem (CID 91192667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).