C14H29N — CID 91192770
N-ethyl-4,4,5,5-tetramethyloctan-2-imine (PubChem CID 91192770) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is N-ethyl-4,4,5,5-tetramethyloctan-2-imine.
| Compound Name | N-ethyl-4,4,5,5-tetramethyloctan-2-imine |
|---|---|
| PubChem CID | 91192770 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | N-ethyl-4,4,5,5-tetramethyloctan-2-imine |
| SMILES | CCCC(C)(C)C(C)(C)C/C(C)=N/CC |
| InChI | InChI=1S/C14H29N/c1-8-10-13(4,5)14(6,7)11-12(3)15-9-2/h8-11H2,1-7H3/b15-12+ |
| InChIKey | VJALQZGFEGAJCC-NTCAYCPXSA-N |
| XLogP | 4.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|