About 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine
2-N,3-N-diethyl-1,4-dithiine-2,3-diimine (PubChem CID 91192860) has the molecular formula C8H12N2S2
and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine.
Molecular Properties
| Compound Name | 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine |
| PubChem CID | 91192860 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine |
| SMILES | CC/N=c1\sccs\c1=N/CC |
| InChI | InChI=1S/C8H12N2S2/c1-3-9-7-8(10-4-2)12-6-5-11-7/h5-6H,3-4H2,1-2H3/b9-7-,10-8- |
| InChIKey | PSEXPVFNCHMTPE-XOHWUJONSA-N |
| XLogP | 1.65 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine?
The IUPAC name of 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine (CID 91192860) is 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine.
What is the SMILES notation for 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine?
The canonical SMILES for 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine is CC/N=c1\sccs\c1=N/CC.
What is the InChIKey of 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine?
The InChIKey is PSEXPVFNCHMTPE-XOHWUJONSA-N. The full InChI is InChI=1S/C8H12N2S2/c1-3-9-7-8(10-4-2)12-6-5-11-7/h5-6H,3-4H2,1-2H3/b9-7-,10-8-.
What are the key properties of 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine?
2-N,3-N-diethyl-1,4-dithiine-2,3-diimine has a molecular weight of 200.33 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,3-N-diethyl-1,4-dithiine-2,3-diimine is sourced from PubChem (CID 91192860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).