About [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate
[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate (PubChem CID 91192998) has the molecular formula C20H23NO3S
and a molecular weight of 357.48 g/mol. Its IUPAC name is [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate.
Molecular Properties
| Compound Name | [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate |
| PubChem CID | 91192998 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate |
| SMILES | CCC(C)c1ccc(S(=O)(=O)O/N=C2/CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C20H23NO3S/c1-3-15(2)16-11-13-18(14-12-16)25(22,23)24-21-20-10-6-8-17-7-4-5-9-19(17)20/h4-5,7,9,11-15H,3,6,8,10H2,1-2H3/b21-20- |
| InChIKey | YZABYVOAUMLZJZ-MRCUWXFGSA-N |
| XLogP | 4.65 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate?
The IUPAC name of [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate (CID 91192998) is [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate.
What is the SMILES notation for [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate?
The canonical SMILES for [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate is CCC(C)c1ccc(S(=O)(=O)O/N=C2/CCCc3ccccc32)cc1.
What is the InChIKey of [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate?
The InChIKey is YZABYVOAUMLZJZ-MRCUWXFGSA-N. The full InChI is InChI=1S/C20H23NO3S/c1-3-15(2)16-11-13-18(14-12-16)25(22,23)24-21-20-10-6-8-17-7-4-5-9-19(17)20/h4-5,7,9,11-15H,3,6,8,10H2,1-2H3/b21-20-.
What are the key properties of [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate?
[(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate has a molecular weight of 357.48 g/mol, XLogP of 4.65, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3,4-dihydro-2H-naphthalen-1-ylideneamino] 4-butan-2-ylbenzenesulfonate is sourced from PubChem (CID 91192998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).