About (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate
(3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate (PubChem CID 91193222) has the molecular formula C17H21BBrNO5
and a molecular weight of 410.07 g/mol. Its IUPAC name is (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate.
Molecular Properties
| Compound Name | (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate |
| PubChem CID | 91193222 |
| Molecular Formula | C17H21BBrNO5 |
| Molecular Weight | 410.07 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate |
| SMILES | COC(=O)[C@@H](C)COc1ccc(Br)cc1.Nc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C11H13BrO3.C6H8BNO2/c1-8(11(13)14-2)7-15-10-5-3-9(12)4-6-10;8-6-3-1-2-5(4-6)7(9)10/h3-6,8H,7H2,1-2H3;1-4,9-10H,8H2/t8-;/m0./s1 |
| InChIKey | PRMULUKGIOBKGA-QRPNPIFTSA-N |
| XLogP | 1.59 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.07 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate?
The IUPAC name of (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate (CID 91193222) is (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate.
What is the SMILES notation for (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate?
The canonical SMILES for (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate is COC(=O)[C@@H](C)COc1ccc(Br)cc1.Nc1cccc(B(O)O)c1.
What is the InChIKey of (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate?
The InChIKey is PRMULUKGIOBKGA-QRPNPIFTSA-N. The full InChI is InChI=1S/C11H13BrO3.C6H8BNO2/c1-8(11(13)14-2)7-15-10-5-3-9(12)4-6-10;8-6-3-1-2-5(4-6)7(9)10/h3-6,8H,7H2,1-2H3;1-4,9-10H,8H2/t8-;/m0./s1.
What are the key properties of (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate?
(3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate has a molecular weight of 410.07 g/mol, XLogP of 1.59, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminophenyl)boronic acid;methyl (2S)-3-(4-bromophenoxy)-2-methylpropanoate is sourced from PubChem (CID 91193222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).