About hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium
hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium (PubChem CID 91193509) has the molecular formula C11H18NO2+
and a molecular weight of 196.27 g/mol. Its IUPAC name is hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium.
Molecular Properties
| Compound Name | hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium |
| PubChem CID | 91193509 |
| Molecular Formula | C11H18NO2+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium |
| SMILES | CC=C[N+](O)=CCC=CC(O)=CCC |
| InChI | InChI=1S/C11H17NO2/c1-3-7-11(13)8-5-6-10-12(14)9-4-2/h4-5,7-10H,3,6H2,1-2H3,(H-,13,14)/p+1 |
| InChIKey | UEVUBKAAJTYTSB-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 43.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium?
The IUPAC name of hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium (CID 91193509) is hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium.
What is the SMILES notation for hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium?
The canonical SMILES for hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium is CC=C[N+](O)=CCC=CC(O)=CCC.
What is the InChIKey of hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium?
The InChIKey is UEVUBKAAJTYTSB-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H17NO2/c1-3-7-11(13)8-5-6-10-12(14)9-4-2/h4-5,7-10H,3,6H2,1-2H3,(H-,13,14)/p+1.
What are the key properties of hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium?
hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium has a molecular weight of 196.27 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-(5-hydroxyocta-3,5-dienylidene)-prop-1-enylazanium is sourced from PubChem (CID 91193509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).