C10H19N3O6 — CID 91193649
2-[4-(2-amino-1,1,2-trihydroxypropyl)-4-hydroxy-2-oxopyrrolidin-1-yl]propanamide (PubChem CID 91193649) has the molecular formula C10H19N3O6 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[4-(2-amino-1,1,2-trihydroxypropyl)-4-hydroxy-2-oxopyrrolidin-1-yl]propanamide.
| Compound Name | 2-[4-(2-amino-1,1,2-trihydroxypropyl)-4-hydroxy-2-oxopyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 91193649 |
| Molecular Formula | C10H19N3O6 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-[4-(2-amino-1,1,2-trihydroxypropyl)-4-hydroxy-2-oxopyrrolidin-1-yl]propanamide |
| SMILES | CC(C(N)=O)N1CC(O)(C(O)(O)C(C)(N)O)CC1=O |
| InChI | InChI=1S/C10H19N3O6/c1-5(7(11)15)13-4-9(17,3-6(13)14)10(18,19)8(2,12)16/h5,16-19H,3-4,12H2,1-2H3,(H2,11,15) |
| InChIKey | WRWPRAOCBWGEDF-UHFFFAOYSA-N |
| XLogP | -3.83 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|