About 5-pentyl-1,3-benzothiazol-7-ol
5-pentyl-1,3-benzothiazol-7-ol (PubChem CID 91193669) has the molecular formula C12H15NOS
and a molecular weight of 221.32 g/mol. Its IUPAC name is 5-pentyl-1,3-benzothiazol-7-ol.
Molecular Properties
| Compound Name | 5-pentyl-1,3-benzothiazol-7-ol |
| PubChem CID | 91193669 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 5-pentyl-1,3-benzothiazol-7-ol |
| SMILES | CCCCCc1cc(O)c2scnc2c1 |
| InChI | InChI=1S/C12H15NOS/c1-2-3-4-5-9-6-10-12(11(14)7-9)15-8-13-10/h6-8,14H,2-5H2,1H3 |
| InChIKey | WKFWKXJWYASKHA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pentyl-1,3-benzothiazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentyl-1,3-benzothiazol-7-ol?
The IUPAC name of 5-pentyl-1,3-benzothiazol-7-ol (CID 91193669) is 5-pentyl-1,3-benzothiazol-7-ol.
What is the SMILES notation for 5-pentyl-1,3-benzothiazol-7-ol?
The canonical SMILES for 5-pentyl-1,3-benzothiazol-7-ol is CCCCCc1cc(O)c2scnc2c1.
What is the InChIKey of 5-pentyl-1,3-benzothiazol-7-ol?
The InChIKey is WKFWKXJWYASKHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NOS/c1-2-3-4-5-9-6-10-12(11(14)7-9)15-8-13-10/h6-8,14H,2-5H2,1H3.
What are the key properties of 5-pentyl-1,3-benzothiazol-7-ol?
5-pentyl-1,3-benzothiazol-7-ol has a molecular weight of 221.32 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentyl-1,3-benzothiazol-7-ol is sourced from PubChem (CID 91193669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).