C12H18O13 — CID 91193706
(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[(2S,3S,4S,5S,6R)-3,4,5,6-tetrahydroxyoxane-2-carbonyl]oxyoxane-2-carboxylic acid (PubChem CID 91193706) has the molecular formula C12H18O13 and a molecular weight of 370.26 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[(2S,3S,4S,5S,6R)-3,4,5,6-tetrahydroxyoxane-2-carbonyl]oxyoxane-2-carboxylic acid.
| Compound Name | (2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[(2S,3S,4S,5S,6R)-3,4,5,6-tetrahydroxyoxane-2-carbonyl]oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 91193706 |
| Molecular Formula | C12H18O13 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | (2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[(2S,3S,4S,5S,6R)-3,4,5,6-tetrahydroxyoxane-2-carbonyl]oxyoxane-2-carboxylic acid |
| SMILES | O=C(O[C@@H]1O[C@@H](C(=O)O)[C@@H](O)[C@H](O)[C@@H]1O)[C@H]1O[C@@H](O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H18O13/c13-1-4(16)8(23-10(21)5(1)17)11(22)25-12-6(18)2(14)3(15)7(24-12)9(19)20/h1-8,10,12-18,21H,(H,19,20)/t1-,2-,3-,4-,5-,6-,7+,8-,10+,12-/m0/s1 |
| InChIKey | SXXFTIVIRDKHEW-ZECYMRHOSA-N |
| XLogP | -5.78 |
| TPSA | 223.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | -5.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |